![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 09-08-2014 Intro to ..> | 2014-09-09 12:39 | 709K | |
| 09-09-2014 Into to T..> | 2014-09-09 12:37 | 1.9M | |
| 09-10-2014 Sine Law.pdf | 2014-09-10 13:30 | 527K | |
| 09-12-2014 Finding t..> | 2014-09-12 12:58 | 196K | |
| 11-09-2014 Cosine La..> | 2014-09-11 12:42 | 529K | |
| Algebraic Models/ | 2014-11-04 17:25 | - | |
| Finances/ | 2014-10-16 11:31 | - | |
| Graphs/ | 2014-11-10 14:59 | - | |
| New Folder/ | 2014-10-28 15:07 | - | |
| Optimizing Areas and..> | 2014-12-04 15:06 | - | |
| Rational Exponents/ | 2014-10-30 15:28 | - | |
| Simple and Compound ..> | 2014-10-09 12:05 | - | |
| Statistics/ | 2014-09-25 12:28 | - | |
| Trigonometry/ | 2014-11-20 12:13 | - | |
| Unit 2 - Measurement/ | 2014-09-17 11:29 | - | |